Z-VRPR-FMK
| Overview | |
| Catalog # | bs-75294c-500ug |
| Product Name | Z-VRPR-FMK |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 3 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 1381885-28-4 (free base) Molecular formula: C31H49FN10O6 . C2HF3O2 Molecular weight: 676.8 . 114.0 Purity: >90% (HPLC) Appearance: White to slightly yellow solid. Solubility: Soluble in water (1mg/ml). InChiKey: DYQKGOBRZWMAHV-YTJMMMLMSA-N SMILES: OC(=O)C(F)(F)F.CC(C)[C@H](NC(=O)OCC1=CC=CC=C1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)NC(CCCNC(N)=N)C(=O)CF |
| Description | Selective cell permeable and irreversible MALT1 inhibitor. Inhibits NF-kappaB-dependent gene expression and affects the growth, proliferation and survival of activated B cell-like diffuse large B cell lymphomas (ABC-DLBCL) and germinal center B cell like diffuse large B cell lymphoma (GCB-DLBCL) cell lines. Shown to inhibit the autoprocessing activity of MCA2ac (calcium dependent) in Trypanosoma brucei. |
Powered by Bioz