Alsterpaullone
| Overview | |
| Catalog # | bs-75370c-1mg |
| Product Name | Alsterpaullone |
| Specifications | |
| Storage Buffer | Powder |
| Storage Condition | Stable for 2 years after receipt when stored at +4°C. |
| Target | |
| Product Information | CAS Number: 237430-03-4 Molecular formula: C16H11N3O3 Molecular weight: 293.3 Purity: >98% (NMR) Appearance: Yellow to brown powder. Solubility: Soluble in DMSO; insoluble in water or 100% ethanol. InChiKey: OLUKILHGKRVDCT-UHFFFAOYSA-N SMILES: [O-][N+](=O)C1=CC2=C(NC3=C2CC(=O)NC2=C3C=CC=C2)C=C1 |
| Description | Potent CDK1/cyclin B (IC50 = 35 nM) inhibitor [1]. Anti-tumor compound [1] Potent inhibitor of CDK2/cyclin A, CDK2/cyclin E (IC50 = 200 nM), CDK5/p25 (IC50 = 40 nM), CDK5/p35 (IC50 = 40 nM) [2, 4]. GSK-3beta (glycogen synthase kinase-3beta) inhibitor [2, 3]. Apoptosis inhibitor [6, 7]. Apoptosis inducer [5]. Angiogenesis inhibitor [8]. |
Powered by Bioz