Chrysomycin B
| Overview | |
| Catalog # | bs-75687c-1mg |
| Product Name | Chrysomycin B |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 1 year after receipt when stored at -20°C. After reconstitution protect from light at -20°C. |
| Target | |
| Product Information | CAS Number: 83852-56-6 Molecular formula: C27H28O9 Molecular weight: 496.5 Purity: >98% (HPLC) Appearance: Yellow to greenish solid. Solubility: Soluble in DMSO or dimethylformamide; slightly soluble in 100% ethanol or methanol. InChiKey: BJPYMDSMDBCKEP-QSMCFSHASA-N SMILES: COC1=CC2=C(OC(=O)C3=CC(C)=CC(OC)=C23)C2=C1C(O)=CC=C2[C@@H]1OC(C)[C@H](O)[C@](C)(O)C1O |
| Description | Antibiotic. Topoisomerase II inhibitor. Mediates a unique cross-linking reaction between DNA and histidine H3. Anti-neoplastic. Photosensitizing compound. Antitumor compound against human cell lines. Less potent than chrysomycin A (Prod. No. bs-75686C). |
Powered by Bioz